About pyrrolo[2,3-b]pyridin-2-one;hydrochloride
pyrrolo[2,3-b]pyridin-2-one;hydrochloride (PubChem CID 174216202) has the molecular formula C7H5ClN2O
and a molecular weight of 168.58 g/mol. Its IUPAC name is pyrrolo[2,3-b]pyridin-2-one;hydrochloride.
Molecular Properties
| Compound Name | pyrrolo[2,3-b]pyridin-2-one;hydrochloride |
| PubChem CID | 174216202 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | pyrrolo[2,3-b]pyridin-2-one;hydrochloride |
| SMILES | Cl.O=C1C=c2cccnc2=N1 |
| InChI | InChI=1S/C7H4N2O.ClH/c10-6-4-5-2-1-3-8-7(5)9-6;/h1-4H;1H |
| InChIKey | YOWOFFVGGBMVTC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolo[2,3-b]pyridin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,3-b]pyridin-2-one;hydrochloride?
The IUPAC name of pyrrolo[2,3-b]pyridin-2-one;hydrochloride (CID 174216202) is pyrrolo[2,3-b]pyridin-2-one;hydrochloride.
What is the SMILES notation for pyrrolo[2,3-b]pyridin-2-one;hydrochloride?
The canonical SMILES for pyrrolo[2,3-b]pyridin-2-one;hydrochloride is Cl.O=C1C=c2cccnc2=N1.
What is the InChIKey of pyrrolo[2,3-b]pyridin-2-one;hydrochloride?
The InChIKey is YOWOFFVGGBMVTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O.ClH/c10-6-4-5-2-1-3-8-7(5)9-6;/h1-4H;1H.
What are the key properties of pyrrolo[2,3-b]pyridin-2-one;hydrochloride?
pyrrolo[2,3-b]pyridin-2-one;hydrochloride has a molecular weight of 168.58 g/mol, XLogP of -0.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,3-b]pyridin-2-one;hydrochloride is sourced from PubChem (CID 174216202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).