About pyrrolo[2,3-b]pyridin-2-one;dihydrochloride
pyrrolo[2,3-b]pyridin-2-one;dihydrochloride (PubChem CID 174216203) has the molecular formula C7H6Cl2N2O
and a molecular weight of 205.04 g/mol. Its IUPAC name is pyrrolo[2,3-b]pyridin-2-one;dihydrochloride.
Molecular Properties
| Compound Name | pyrrolo[2,3-b]pyridin-2-one;dihydrochloride |
| PubChem CID | 174216203 |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | pyrrolo[2,3-b]pyridin-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1C=c2cccnc2=N1 |
| InChI | InChI=1S/C7H4N2O.2ClH/c10-6-4-5-2-1-3-8-7(5)9-6;;/h1-4H;2*1H |
| InChIKey | YHVBMFJGBAMPNF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolo[2,3-b]pyridin-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,3-b]pyridin-2-one;dihydrochloride?
The IUPAC name of pyrrolo[2,3-b]pyridin-2-one;dihydrochloride (CID 174216203) is pyrrolo[2,3-b]pyridin-2-one;dihydrochloride.
What is the SMILES notation for pyrrolo[2,3-b]pyridin-2-one;dihydrochloride?
The canonical SMILES for pyrrolo[2,3-b]pyridin-2-one;dihydrochloride is Cl.Cl.O=C1C=c2cccnc2=N1.
What is the InChIKey of pyrrolo[2,3-b]pyridin-2-one;dihydrochloride?
The InChIKey is YHVBMFJGBAMPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O.2ClH/c10-6-4-5-2-1-3-8-7(5)9-6;;/h1-4H;2*1H.
What are the key properties of pyrrolo[2,3-b]pyridin-2-one;dihydrochloride?
pyrrolo[2,3-b]pyridin-2-one;dihydrochloride has a molecular weight of 205.04 g/mol, XLogP of -0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,3-b]pyridin-2-one;dihydrochloride is sourced from PubChem (CID 174216203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).