1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid

C10H17F3N2O2 — CID 174217769

IUPAC1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid
SMILESNC1CCCN(C2CC2)C1.O=C(O)C(F)(F)F
InChIInChI=1S/C8H16N2.C2HF3O2/c9-7-2-1-5-10(6-7)8-3-4-8;3-2(4,5)1(6)7/h7-8H,1-6,9H2;(H,6,7)
InChIKeyFYMFDJSSPGQUHH-UHFFFAOYSA-N
MW254.25 g/mol
LogP1.21
Rot. Bonds1

About 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid

1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 174217769) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid
PubChem CID174217769
Molecular FormulaC10H17F3N2O2
Molecular Weight254.25 g/mol
Exact Mass254.12
IUPAC Name1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid
SMILESNC1CCCN(C2CC2)C1.O=C(O)C(F)(F)F
InChIInChI=1S/C8H16N2.C2HF3O2/c9-7-2-1-5-10(6-7)8-3-4-8;3-2(4,5)1(6)7/h7-8H,1-6,9H2;(H,6,7)
InChIKeyFYMFDJSSPGQUHH-UHFFFAOYSA-N
XLogP1.21
TPSA66.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.25
LogP ≤ 51.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid?
The IUPAC name of 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid (CID 174217769) is 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid?
The canonical SMILES for 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid is NC1CCCN(C2CC2)C1.O=C(O)C(F)(F)F.
What is the InChIKey of 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid?
The InChIKey is FYMFDJSSPGQUHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.C2HF3O2/c9-7-2-1-5-10(6-7)8-3-4-8;3-2(4,5)1(6)7/h7-8H,1-6,9H2;(H,6,7).
What are the key properties of 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid?
1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid has a molecular weight of 254.25 g/mol, XLogP of 1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylpiperidin-3-amine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 174217769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).