About 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol
5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol (PubChem CID 174218847) has the molecular formula C17H13N3OS
and a molecular weight of 307.38 g/mol. Its IUPAC name is 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol.
Molecular Properties
| Compound Name | 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol |
| PubChem CID | 174218847 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol |
| SMILES | Cc1cc2cc3nccc(Nc4cncc(O)c4)c3cc2s1 |
| InChI | InChI=1S/C17H13N3OS/c1-10-4-11-5-16-14(7-17(11)22-10)15(2-3-19-16)20-12-6-13(21)9-18-8-12/h2-9,21H,1H3,(H,19,20) |
| InChIKey | IEBIQVRZYQOQGS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol?
The IUPAC name of 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol (CID 174218847) is 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol.
What is the SMILES notation for 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol?
The canonical SMILES for 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol is Cc1cc2cc3nccc(Nc4cncc(O)c4)c3cc2s1.
What is the InChIKey of 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol?
The InChIKey is IEBIQVRZYQOQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3OS/c1-10-4-11-5-16-14(7-17(11)22-10)15(2-3-19-16)20-12-6-13(21)9-18-8-12/h2-9,21H,1H3,(H,19,20).
What are the key properties of 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol?
5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol has a molecular weight of 307.38 g/mol, XLogP of 4.60, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]pyridin-3-ol is sourced from PubChem (CID 174218847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).