About lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride
lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride (PubChem CID 174219263) has the molecular formula C8H7ClF2LiNO2
and a molecular weight of 229.54 g/mol. Its IUPAC name is lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride.
Molecular Properties
| Compound Name | lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride |
| PubChem CID | 174219263 |
| Molecular Formula | C8H7ClF2LiNO2 |
| Molecular Weight | 229.54 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride |
| SMILES | Nc1ccc(Cl)cc1C(F)(F)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C8H6ClF2NO2.Li.H/c9-4-1-2-6(12)5(3-4)8(10,11)7(13)14;;/h1-3H,12H2,(H,13,14);;/q;+1;-1 |
| InChIKey | UTTDCVVZPMJMPP-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.54 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride?
The IUPAC name of lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride (CID 174219263) is lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride.
What is the SMILES notation for lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride?
The canonical SMILES for lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride is Nc1ccc(Cl)cc1C(F)(F)C(=O)O.[H-].[Li+].
What is the InChIKey of lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride?
The InChIKey is UTTDCVVZPMJMPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF2NO2.Li.H/c9-4-1-2-6(12)5(3-4)8(10,11)7(13)14;;/h1-3H,12H2,(H,13,14);;/q;+1;-1.
What are the key properties of lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride?
lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride has a molecular weight of 229.54 g/mol, XLogP of -0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2-(2-amino-5-chlorophenyl)-2,2-difluoroacetic acid;hydride is sourced from PubChem (CID 174219263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).