C22H27N5O2 — CID 174219918
1-[4-[7-[1-(2-hydroxyphenyl)ethyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 174219918) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-[4-[7-[1-(2-hydroxyphenyl)ethyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-[1-(2-hydroxyphenyl)ethyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 174219918 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-[4-[7-[1-(2-hydroxyphenyl)ethyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c2CCN(C(C)c2ccccc2O)C3)CC1 |
| InChI | InChI=1S/C22H27N5O2/c1-3-21(29)25-10-12-26(13-11-25)22-18-8-9-27(14-19(18)23-15-24-22)16(2)17-6-4-5-7-20(17)28/h3-7,15-16,28H,1,8-14H2,2H3 |
| InChIKey | LGLCUOSCOLXFFH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|