About tributylgermane
tributylgermane (PubChem CID 17422) has the molecular formula C12H28Ge
and a molecular weight of 244.97 g/mol. Its IUPAC name is tributylgermane.
Molecular Properties
| Compound Name | tributylgermane |
| PubChem CID | 17422 |
| Molecular Formula | C12H28Ge |
| Molecular Weight | 244.97 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | tributylgermane |
| SMILES | CCCC[GeH](CCCC)CCCC |
| InChI | InChI=1S/C12H28Ge/c1-4-7-10-13(11-8-5-2)12-9-6-3/h13H,4-12H2,1-3H3 |
| InChIKey | KTSWILXIWHVQLR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.97 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tributylgermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributylgermane?
The IUPAC name of tributylgermane (CID 17422) is tributylgermane.
What is the SMILES notation for tributylgermane?
The canonical SMILES for tributylgermane is CCCC[GeH](CCCC)CCCC.
What is the InChIKey of tributylgermane?
The InChIKey is KTSWILXIWHVQLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28Ge/c1-4-7-10-13(11-8-5-2)12-9-6-3/h13H,4-12H2,1-3H3.
What are the key properties of tributylgermane?
tributylgermane has a molecular weight of 244.97 g/mol, XLogP of 4.61, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributylgermane is sourced from PubChem (CID 17422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).