About tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium
tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium (PubChem CID 174220292) has the molecular formula C10H21F2NOS
and a molecular weight of 241.35 g/mol. Its IUPAC name is tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium.
Molecular Properties
| Compound Name | tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium |
| PubChem CID | 174220292 |
| Molecular Formula | C10H21F2NOS |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium |
| SMILES | CCC(CCC(F)F)N[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C10H21F2NOS/c1-5-8(6-7-9(11)12)13-15(14)10(2,3)4/h8-9,13H,5-7H2,1-4H3 |
| InChIKey | RPVSFTNXZCFLDX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium?
The IUPAC name of tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium (CID 174220292) is tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium.
What is the SMILES notation for tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium?
The canonical SMILES for tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium is CCC(CCC(F)F)N[S+]([O-])C(C)(C)C.
What is the InChIKey of tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium?
The InChIKey is RPVSFTNXZCFLDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F2NOS/c1-5-8(6-7-9(11)12)13-15(14)10(2,3)4/h8-9,13H,5-7H2,1-4H3.
What are the key properties of tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium?
tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium has a molecular weight of 241.35 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(6,6-difluorohexan-3-ylamino)-oxidosulfanium is sourced from PubChem (CID 174220292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).