About tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium
tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium (PubChem CID 174220387) has the molecular formula C9H15F3N2OS
and a molecular weight of 256.29 g/mol. Its IUPAC name is tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium.
Molecular Properties
| Compound Name | tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium |
| PubChem CID | 174220387 |
| Molecular Formula | C9H15F3N2OS |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC(CCC#N)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2OS/c1-8(2,3)16(15)14-7(5-4-6-13)9(10,11)12/h7,14H,4-5H2,1-3H3 |
| InChIKey | IAEMXUWKBHIWLY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium?
The IUPAC name of tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium (CID 174220387) is tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium.
What is the SMILES notation for tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium?
The canonical SMILES for tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium is CC(C)(C)[S+]([O-])NC(CCC#N)C(F)(F)F.
What is the InChIKey of tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium?
The InChIKey is IAEMXUWKBHIWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2OS/c1-8(2,3)16(15)14-7(5-4-6-13)9(10,11)12/h7,14H,4-5H2,1-3H3.
What are the key properties of tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium?
tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium has a molecular weight of 256.29 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(4-cyano-1,1,1-trifluorobutan-2-yl)amino]-oxidosulfanium is sourced from PubChem (CID 174220387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).