C13H19BrN2 — CID 174220974
1-hexylimidazo[1,2-a]pyridin-1-ium bromide (PubChem CID 174220974) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 1-hexylimidazo[1,2-a]pyridin-1-ium bromide.
| Compound Name | 1-hexylimidazo[1,2-a]pyridin-1-ium bromide |
|---|---|
| PubChem CID | 174220974 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-hexylimidazo[1,2-a]pyridin-1-ium bromide |
| SMILES | CCCCCC[n+]1ccn2ccccc21.[Br-] |
| InChI | InChI=1S/C13H19N2.BrH/c1-2-3-4-6-9-14-11-12-15-10-7-5-8-13(14)15;/h5,7-8,10-12H,2-4,6,9H2,1H3;1H/q+1;/p-1 |
| InChIKey | UYGDPBJQVNGKKM-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|