About 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol
2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol (PubChem CID 174221231) has the molecular formula C15H14O3S2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol.
Molecular Properties
| Compound Name | 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol |
| PubChem CID | 174221231 |
| Molecular Formula | C15H14O3S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol |
| SMILES | COc1ccc(C2SCc3c(O)cccc3S2)cc1O |
| InChI | InChI=1S/C15H14O3S2/c1-18-13-6-5-9(7-12(13)17)15-19-8-10-11(16)3-2-4-14(10)20-15/h2-7,15-17H,8H2,1H3 |
| InChIKey | PZQDDXKVXZUCHR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol?
The IUPAC name of 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol (CID 174221231) is 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol.
What is the SMILES notation for 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol?
The canonical SMILES for 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol is COc1ccc(C2SCc3c(O)cccc3S2)cc1O.
What is the InChIKey of 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol?
The InChIKey is PZQDDXKVXZUCHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3S2/c1-18-13-6-5-9(7-12(13)17)15-19-8-10-11(16)3-2-4-14(10)20-15/h2-7,15-17H,8H2,1H3.
What are the key properties of 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol?
2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol has a molecular weight of 306.41 g/mol, XLogP of 4.14, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxy-4-methoxyphenyl)-4H-1,3-benzodithiin-5-ol is sourced from PubChem (CID 174221231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).