C27H34O16 — CID 174221411
1-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-2,6-dihydroxyphenyl]-3-(3,4,5-trihydroxyphenyl)propan-1-one (PubChem CID 174221411) has the molecular formula C27H34O16 and a molecular weight of 614.55 g/mol. Its IUPAC name is 1-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-2,6-dihydroxyphenyl]-3-(3,4,5-trihydroxyphenyl)propan-1-one.
| Compound Name | 1-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-2,6-dihydroxyphenyl]-3-(3,4,5-trihydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 174221411 |
| Molecular Formula | C27H34O16 |
| Molecular Weight | 614.55 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | 1-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-2,6-dihydroxyphenyl]-3-(3,4,5-trihydroxyphenyl)propan-1-one |
| SMILES | CC1OC(OC2C(Oc3cc(O)c(C(=O)CCc4cc(O)c(O)c(O)c4)c(O)c3)OC(CO)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C27H34O16/c1-9-19(34)22(37)24(39)26(40-9)43-25-23(38)21(36)17(8-28)42-27(25)41-11-6-13(30)18(14(31)7-11)12(29)3-2-10-4-15(32)20(35)16(33)5-10/h4-7,9,17,19,21-28,30-39H,2-3,8H2,1H3 |
| InChIKey | PQOORCHYPUEKEJ-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 276.52 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.55 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|