About sodium;hydride;thietan-3-ylsulfamic acid
sodium;hydride;thietan-3-ylsulfamic acid (PubChem CID 174221416) has the molecular formula C3H8NNaO3S2
and a molecular weight of 193.22 g/mol. Its IUPAC name is sodium;hydride;thietan-3-ylsulfamic acid.
Molecular Properties
| Compound Name | sodium;hydride;thietan-3-ylsulfamic acid |
| PubChem CID | 174221416 |
| Molecular Formula | C3H8NNaO3S2 |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 192.98 |
| IUPAC Name | sodium;hydride;thietan-3-ylsulfamic acid |
| SMILES | O=S(=O)(O)NC1CSC1.[H-].[Na+] |
| InChI | InChI=1S/C3H7NO3S2.Na.H/c5-9(6,7)4-3-1-8-2-3;;/h3-4H,1-2H2,(H,5,6,7);;/q;+1;-1 |
| InChIKey | PFKCZPGKTDCWFC-UHFFFAOYSA-N |
| XLogP | -3.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;thietan-3-ylsulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;thietan-3-ylsulfamic acid?
The IUPAC name of sodium;hydride;thietan-3-ylsulfamic acid (CID 174221416) is sodium;hydride;thietan-3-ylsulfamic acid.
What is the SMILES notation for sodium;hydride;thietan-3-ylsulfamic acid?
The canonical SMILES for sodium;hydride;thietan-3-ylsulfamic acid is O=S(=O)(O)NC1CSC1.[H-].[Na+].
What is the InChIKey of sodium;hydride;thietan-3-ylsulfamic acid?
The InChIKey is PFKCZPGKTDCWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO3S2.Na.H/c5-9(6,7)4-3-1-8-2-3;;/h3-4H,1-2H2,(H,5,6,7);;/q;+1;-1.
What are the key properties of sodium;hydride;thietan-3-ylsulfamic acid?
sodium;hydride;thietan-3-ylsulfamic acid has a molecular weight of 193.22 g/mol, XLogP of -3.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;thietan-3-ylsulfamic acid is sourced from PubChem (CID 174221416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).