C18H17Cl2N7O2 — CID 174222034
1-(2,4-dichloro-5-prop-2-enoxyphenyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 174222034) has the molecular formula C18H17Cl2N7O2 and a molecular weight of 434.29 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-prop-2-enoxyphenyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-(2,4-dichloro-5-prop-2-enoxyphenyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 174222034 |
| Molecular Formula | C18H17Cl2N7O2 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 1-(2,4-dichloro-5-prop-2-enoxyphenyl)-3-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | C=CCOc1cc(NC(=O)NC(C)c2ncnn2-c2ncccn2)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2N7O2/c1-3-7-29-15-9-14(12(19)8-13(15)20)26-18(28)25-11(2)16-23-10-24-27(16)17-21-5-4-6-22-17/h3-6,8-11H,1,7H2,2H3,(H2,25,26,28) |
| InChIKey | IQOFJOLKBKJIQL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|