About 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione
5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione (PubChem CID 174222331) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione |
| PubChem CID | 174222331 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(O)(CCO)C1CCO |
| InChI | InChI=1S/C10H14O5/c11-5-3-7-8(13)1-2-9(14)10(7,15)4-6-12/h1-2,7,11-12,15H,3-6H2 |
| InChIKey | XCCSOUPHMASEIZ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione?
The IUPAC name of 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione (CID 174222331) is 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione.
What is the SMILES notation for 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione?
The canonical SMILES for 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione is O=C1C=CC(=O)C(O)(CCO)C1CCO.
What is the InChIKey of 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione?
The InChIKey is XCCSOUPHMASEIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5/c11-5-3-7-8(13)1-2-9(14)10(7,15)4-6-12/h1-2,7,11-12,15H,3-6H2.
What are the key properties of 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione?
5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione has a molecular weight of 214.22 g/mol, XLogP of -1.19, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-5,6-bis(2-hydroxyethyl)cyclohex-2-ene-1,4-dione is sourced from PubChem (CID 174222331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).