C24H28BrF3N4O3 — CID 174222516
6-bromo-2-N-(2,2-diethoxyethyl)-7-methoxy-4-N-[1-[3-(trifluoromethyl)phenyl]ethyl]quinazoline-2,4-diamine (PubChem CID 174222516) has the molecular formula C24H28BrF3N4O3 and a molecular weight of 557.41 g/mol. Its IUPAC name is 6-bromo-2-N-(2,2-diethoxyethyl)-7-methoxy-4-N-[1-[3-(trifluoromethyl)phenyl]ethyl]quinazoline-2,4-diamine.
| Compound Name | 6-bromo-2-N-(2,2-diethoxyethyl)-7-methoxy-4-N-[1-[3-(trifluoromethyl)phenyl]ethyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 174222516 |
| Molecular Formula | C24H28BrF3N4O3 |
| Molecular Weight | 557.41 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 6-bromo-2-N-(2,2-diethoxyethyl)-7-methoxy-4-N-[1-[3-(trifluoromethyl)phenyl]ethyl]quinazoline-2,4-diamine |
| SMILES | CCOC(CNc1nc(NC(C)c2cccc(C(F)(F)F)c2)c2cc(Br)c(OC)cc2n1)OCC |
| InChI | InChI=1S/C24H28BrF3N4O3/c1-5-34-21(35-6-2)13-29-23-31-19-12-20(33-4)18(25)11-17(19)22(32-23)30-14(3)15-8-7-9-16(10-15)24(26,27)28/h7-12,14,21H,5-6,13H2,1-4H3,(H2,29,30,31,32) |
| InChIKey | LMZQAHIPHGVZCX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.41 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|