About (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate
(5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate (PubChem CID 174223429) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate |
| PubChem CID | 174223429 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CC(O)CO)C1 |
| InChI | InChI=1S/C14H26O4/c1-9(2)12-5-4-10(3)6-13(12)18-14(17)7-11(16)8-15/h9-13,15-16H,4-8H2,1-3H3 |
| InChIKey | RJWKFYWFXOBVPR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate (CID 174223429) is (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate is CC1CCC(C(C)C)C(OC(=O)CC(O)CO)C1.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate?
The InChIKey is RJWKFYWFXOBVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4/c1-9(2)12-5-4-10(3)6-13(12)18-14(17)7-11(16)8-15/h9-13,15-16H,4-8H2,1-3H3.
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate?
(5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate has a molecular weight of 258.36 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) 3,4-dihydroxybutanoate is sourced from PubChem (CID 174223429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).