About 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate
4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate (PubChem CID 174224326) has the molecular formula C25H28N4O4
and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate.
Molecular Properties
| Compound Name | 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate |
| PubChem CID | 174224326 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate |
| SMILES | C/C=C/CN(Cc1ccccc1)C(=O)c1cnc(C)nc1Nc1ccccc1.COC(=O)O |
| InChI | InChI=1S/C23H24N4O.C2H4O3/c1-3-4-15-27(17-19-11-7-5-8-12-19)23(28)21-16-24-18(2)25-22(21)26-20-13-9-6-10-14-20;1-5-2(3)4/h3-14,16H,15,17H2,1-2H3,(H,24,25,26);1H3,(H,3,4)/b4-3+; |
| InChIKey | LWKINICRLHIURE-BJILWQEISA-N |
| XLogP | 5.06 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate?
The IUPAC name of 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate (CID 174224326) is 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate.
What is the SMILES notation for 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate?
The canonical SMILES for 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate is C/C=C/CN(Cc1ccccc1)C(=O)c1cnc(C)nc1Nc1ccccc1.COC(=O)O.
What is the InChIKey of 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate?
The InChIKey is LWKINICRLHIURE-BJILWQEISA-N. The full InChI is InChI=1S/C23H24N4O.C2H4O3/c1-3-4-15-27(17-19-11-7-5-8-12-19)23(28)21-16-24-18(2)25-22(21)26-20-13-9-6-10-14-20;1-5-2(3)4/h3-14,16H,15,17H2,1-2H3,(H,24,25,26);1H3,(H,3,4)/b4-3+;.
What are the key properties of 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate?
4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate has a molecular weight of 448.52 g/mol, XLogP of 5.06, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-N-benzyl-N-[(E)-but-2-enyl]-2-methylpyrimidine-5-carboxamide;methyl hydrogen carbonate is sourced from PubChem (CID 174224326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).