C29H26ClFN4O5 — CID 174224785
[(2S,4R,5R)-4-acetyloxy-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3-methylideneoxolan-2-yl]methyl benzoate (PubChem CID 174224785) has the molecular formula C29H26ClFN4O5 and a molecular weight of 565.00 g/mol. Its IUPAC name is [(2S,4R,5R)-4-acetyloxy-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3-methylideneoxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,4R,5R)-4-acetyloxy-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3-methylideneoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 174224785 |
| Molecular Formula | C29H26ClFN4O5 |
| Molecular Weight | 565.00 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | [(2S,4R,5R)-4-acetyloxy-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3-methylideneoxolan-2-yl]methyl benzoate |
| SMILES | C=C1[C@@H](OC(C)=O)[C@H](n2ncc3c(N[C@@H](C)c4ccccc4F)cc(Cl)nc32)O[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H26ClFN4O5/c1-16-24(15-38-29(37)19-9-5-4-6-10-19)40-28(26(16)39-18(3)36)35-27-21(14-32-35)23(13-25(30)34-27)33-17(2)20-11-7-8-12-22(20)31/h4-14,17,24,26,28H,1,15H2,2-3H3,(H,33,34)/t17-,24+,26+,28+/m0/s1 |
| InChIKey | DAVQYUXUFMEQTC-GWHWZPLTSA-N |
| XLogP | 5.64 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.00 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|