About [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid
[1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid (PubChem CID 174225411) has the molecular formula C18H23N3O4
and a molecular weight of 345.40 g/mol. Its IUPAC name is [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid.
Molecular Properties
| Compound Name | [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid |
| PubChem CID | 174225411 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid |
| SMILES | O=C(O)NCC1CCN(c2ccc(C3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C18H23N3O4/c22-16-6-5-15(17(23)20-16)13-1-3-14(4-2-13)21-9-7-12(8-10-21)11-19-18(24)25/h1-4,12,15,19H,5-11H2,(H,24,25)(H,20,22,23) |
| InChIKey | SSLVOASRSYQDJC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid?
The IUPAC name of [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid (CID 174225411) is [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid.
What is the SMILES notation for [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid?
The canonical SMILES for [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid is O=C(O)NCC1CCN(c2ccc(C3CCC(=O)NC3=O)cc2)CC1.
What is the InChIKey of [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid?
The InChIKey is SSLVOASRSYQDJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O4/c22-16-6-5-15(17(23)20-16)13-1-3-14(4-2-13)21-9-7-12(8-10-21)11-19-18(24)25/h1-4,12,15,19H,5-11H2,(H,24,25)(H,20,22,23).
What are the key properties of [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid?
[1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid has a molecular weight of 345.40 g/mol, XLogP of 1.69, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperidin-4-yl]methylcarbamic acid is sourced from PubChem (CID 174225411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).