About 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine
2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine (PubChem CID 174226141) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine.
Molecular Properties
| Compound Name | 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| PubChem CID | 174226141 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| SMILES | CC(O)C(=O)O.Cc1ncccc1[C@@H]1CCCN1C |
| InChI | InChI=1S/C11H16N2.C3H6O3/c1-9-10(5-3-7-12-9)11-6-4-8-13(11)2;1-2(4)3(5)6/h3,5,7,11H,4,6,8H2,1-2H3;2,4H,1H3,(H,5,6)/t11-;/m0./s1 |
| InChIKey | CMXYGPOMCPDFSL-MERQFXBCSA-N |
| XLogP | 1.61 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine?
The IUPAC name of 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine (CID 174226141) is 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine.
What is the SMILES notation for 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine?
The canonical SMILES for 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine is CC(O)C(=O)O.Cc1ncccc1[C@@H]1CCCN1C.
What is the InChIKey of 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine?
The InChIKey is CMXYGPOMCPDFSL-MERQFXBCSA-N. The full InChI is InChI=1S/C11H16N2.C3H6O3/c1-9-10(5-3-7-12-9)11-6-4-8-13(11)2;1-2(4)3(5)6/h3,5,7,11H,4,6,8H2,1-2H3;2,4H,1H3,(H,5,6)/t11-;/m0./s1.
What are the key properties of 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine?
2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine has a molecular weight of 266.34 g/mol, XLogP of 1.61, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoic acid;2-methyl-3-[(2S)-1-methylpyrrolidin-2-yl]pyridine is sourced from PubChem (CID 174226141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).