C18H19FN2O2 — CID 174226522
[(1S)-6-(2-fluoro-4-pyridinyl)-2,2-dimethyl-3,4-dihydro-1H-naphthalen-1-yl]carbamic acid (PubChem CID 174226522) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is [(1S)-6-(2-fluoro-4-pyridinyl)-2,2-dimethyl-3,4-dihydro-1H-naphthalen-1-yl]carbamic acid.
| Compound Name | [(1S)-6-(2-fluoro-4-pyridinyl)-2,2-dimethyl-3,4-dihydro-1H-naphthalen-1-yl]carbamic acid |
|---|---|
| PubChem CID | 174226522 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(1S)-6-(2-fluoro-4-pyridinyl)-2,2-dimethyl-3,4-dihydro-1H-naphthalen-1-yl]carbamic acid |
| SMILES | CC1(C)CCc2cc(-c3ccnc(F)c3)ccc2[C@H]1NC(=O)O |
| InChI | InChI=1S/C18H19FN2O2/c1-18(2)7-5-13-9-11(12-6-8-20-15(19)10-12)3-4-14(13)16(18)21-17(22)23/h3-4,6,8-10,16,21H,5,7H2,1-2H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | VKEGSHQHKXDIHA-MRXNPFEDSA-N |
| XLogP | 4.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|