About 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid
2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid (PubChem CID 174226715) has the molecular formula C13H12BrF3N2O7S
and a molecular weight of 477.21 g/mol. Its IUPAC name is 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid |
| PubChem CID | 174226715 |
| Molecular Formula | C13H12BrF3N2O7S |
| Molecular Weight | 477.21 g/mol |
| Exact Mass | 475.95 |
| IUPAC Name | 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid |
| SMILES | O=C(O)N1CCN(C(=O)O)C(c2cc(OS(=O)(=O)C(F)(F)F)ccc2Br)C1 |
| InChI | InChI=1S/C13H12BrF3N2O7S/c14-9-2-1-7(26-27(24,25)13(15,16)17)5-8(9)10-6-18(11(20)21)3-4-19(10)12(22)23/h1-2,5,10H,3-4,6H2,(H,20,21)(H,22,23) |
| InChIKey | SCFZWYKSQADKKS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid?
The IUPAC name of 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid (CID 174226715) is 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid.
What is the SMILES notation for 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid?
The canonical SMILES for 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid is O=C(O)N1CCN(C(=O)O)C(c2cc(OS(=O)(=O)C(F)(F)F)ccc2Br)C1.
What is the InChIKey of 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid?
The InChIKey is SCFZWYKSQADKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrF3N2O7S/c14-9-2-1-7(26-27(24,25)13(15,16)17)5-8(9)10-6-18(11(20)21)3-4-19(10)12(22)23/h1-2,5,10H,3-4,6H2,(H,20,21)(H,22,23).
What are the key properties of 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid?
2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid has a molecular weight of 477.21 g/mol, XLogP of 2.69, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-bromo-5-(trifluoromethylsulfonyloxy)phenyl]piperazine-1,4-dicarboxylic acid is sourced from PubChem (CID 174226715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).