C24H22ClF3N6O4 — CID 174226767
5-[(4aR,7R,8aR)-8-azido-7-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazol-3-amine (PubChem CID 174226767) has the molecular formula C24H22ClF3N6O4 and a molecular weight of 550.93 g/mol. Its IUPAC name is 5-[(4aR,7R,8aR)-8-azido-7-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazol-3-amine.
| Compound Name | 5-[(4aR,7R,8aR)-8-azido-7-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 174226767 |
| Molecular Formula | C24H22ClF3N6O4 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 5-[(4aR,7R,8aR)-8-azido-7-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazol-3-amine |
| SMILES | CO[C@H]1CO[C@@H]2COC(c3ccccc3)O[C@@H]2C1(N=[N+]=[N-])c1cc(N)nn1-c1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C24H22ClF3N6O4/c1-35-19-12-36-17-11-37-22(13-5-3-2-4-6-13)38-21(17)23(19,32-33-30)18-10-20(29)31-34(18)16-9-14(25)7-8-15(16)24(26,27)28/h2-10,17,19,21-22H,11-12H2,1H3,(H2,29,31)/t17-,19+,21+,22?,23?/m1/s1 |
| InChIKey | QYPJJQHNJWFVGO-PNARHLTRSA-N |
| XLogP | 5.16 |
| TPSA | 129.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|