About 2-methylpropan-1-amine;tetraiodostannane
2-methylpropan-1-amine;tetraiodostannane (PubChem CID 174226864) has the molecular formula C4H11I4NSn
and a molecular weight of 699.47 g/mol. Its IUPAC name is 2-methylpropan-1-amine;tetraiodostannane.
Molecular Properties
| Compound Name | 2-methylpropan-1-amine;tetraiodostannane |
| PubChem CID | 174226864 |
| Molecular Formula | C4H11I4NSn |
| Molecular Weight | 699.47 g/mol |
| Exact Mass | 700.61 |
| IUPAC Name | 2-methylpropan-1-amine;tetraiodostannane |
| SMILES | CC(C)CN.I[Sn](I)(I)I |
| InChI | InChI=1S/C4H11N.4HI.Sn/c1-4(2)3-5;;;;;/h4H,3,5H2,1-2H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | MDLCNEBMYZYUHT-UHFFFAOYSA-J |
| XLogP | 3.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 699.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropan-1-amine;tetraiodostannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-1-amine;tetraiodostannane?
The IUPAC name of 2-methylpropan-1-amine;tetraiodostannane (CID 174226864) is 2-methylpropan-1-amine;tetraiodostannane.
What is the SMILES notation for 2-methylpropan-1-amine;tetraiodostannane?
The canonical SMILES for 2-methylpropan-1-amine;tetraiodostannane is CC(C)CN.I[Sn](I)(I)I.
What is the InChIKey of 2-methylpropan-1-amine;tetraiodostannane?
The InChIKey is MDLCNEBMYZYUHT-UHFFFAOYSA-J. The full InChI is InChI=1S/C4H11N.4HI.Sn/c1-4(2)3-5;;;;;/h4H,3,5H2,1-2H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of 2-methylpropan-1-amine;tetraiodostannane?
2-methylpropan-1-amine;tetraiodostannane has a molecular weight of 699.47 g/mol, XLogP of 3.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-1-amine;tetraiodostannane is sourced from PubChem (CID 174226864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).