C21H19F3N2O7S — CID 174227830
2-(3-methoxy-5,6,7,8-tetrahydroquinolin-5-yl)-1-oxo-5-(trifluoromethylsulfonyloxy)-3,4-dihydroisoquinoline-7-carboxylic acid (PubChem CID 174227830) has the molecular formula C21H19F3N2O7S and a molecular weight of 500.45 g/mol. Its IUPAC name is 2-(3-methoxy-5,6,7,8-tetrahydroquinolin-5-yl)-1-oxo-5-(trifluoromethylsulfonyloxy)-3,4-dihydroisoquinoline-7-carboxylic acid.
| Compound Name | 2-(3-methoxy-5,6,7,8-tetrahydroquinolin-5-yl)-1-oxo-5-(trifluoromethylsulfonyloxy)-3,4-dihydroisoquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 174227830 |
| Molecular Formula | C21H19F3N2O7S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 2-(3-methoxy-5,6,7,8-tetrahydroquinolin-5-yl)-1-oxo-5-(trifluoromethylsulfonyloxy)-3,4-dihydroisoquinoline-7-carboxylic acid |
| SMILES | COc1cnc2c(c1)C(N1CCc3c(OS(=O)(=O)C(F)(F)F)cc(C(=O)O)cc3C1=O)CCC2 |
| InChI | InChI=1S/C21H19F3N2O7S/c1-32-12-9-15-16(25-10-12)3-2-4-17(15)26-6-5-13-14(19(26)27)7-11(20(28)29)8-18(13)33-34(30,31)21(22,23)24/h7-10,17H,2-6H2,1H3,(H,28,29) |
| InChIKey | UAWRTVHMFHOZGN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|