C26H22N4O2 — CID 174228988
6-benzyl-8-ethenyl-2-(furan-2-yl)-9-phenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one (PubChem CID 174228988) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 6-benzyl-8-ethenyl-2-(furan-2-yl)-9-phenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one.
| Compound Name | 6-benzyl-8-ethenyl-2-(furan-2-yl)-9-phenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 174228988 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 6-benzyl-8-ethenyl-2-(furan-2-yl)-9-phenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one |
| SMILES | C=CC1CN(Cc2ccccc2)C(=O)c2cnc(-c3ccco3)nc2N1c1ccccc1 |
| InChI | InChI=1S/C26H22N4O2/c1-2-20-18-29(17-19-10-5-3-6-11-19)26(31)22-16-27-24(23-14-9-15-32-23)28-25(22)30(20)21-12-7-4-8-13-21/h2-16,20H,1,17-18H2 |
| InChIKey | PMGHGEYMRNRUGV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|