C28H25N5O — CID 174229040
2-anilino-6-benzyl-8-ethenyl-9-phenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one (PubChem CID 174229040) has the molecular formula C28H25N5O and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-anilino-6-benzyl-8-ethenyl-9-phenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one.
| Compound Name | 2-anilino-6-benzyl-8-ethenyl-9-phenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 174229040 |
| Molecular Formula | C28H25N5O |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 2-anilino-6-benzyl-8-ethenyl-9-phenyl-7,8-dihydropyrimido[4,5-e][1,4]diazepin-5-one |
| SMILES | C=CC1CN(Cc2ccccc2)C(=O)c2cnc(Nc3ccccc3)nc2N1c1ccccc1 |
| InChI | InChI=1S/C28H25N5O/c1-2-23-20-32(19-21-12-6-3-7-13-21)27(34)25-18-29-28(30-22-14-8-4-9-15-22)31-26(25)33(23)24-16-10-5-11-17-24/h2-18,23H,1,19-20H2,(H,29,30,31) |
| InChIKey | LYCQXJPFCFHONL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|