C23H25F3N2S — CID 174229976
(5aR,6S,7R)-5a,6-dimethyl-7-prop-1-en-2-yl-N-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-benzo[g][1,3]benzothiazol-2-amine (PubChem CID 174229976) has the molecular formula C23H25F3N2S and a molecular weight of 418.53 g/mol. Its IUPAC name is (5aR,6S,7R)-5a,6-dimethyl-7-prop-1-en-2-yl-N-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-benzo[g][1,3]benzothiazol-2-amine.
| Compound Name | (5aR,6S,7R)-5a,6-dimethyl-7-prop-1-en-2-yl-N-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-benzo[g][1,3]benzothiazol-2-amine |
|---|---|
| PubChem CID | 174229976 |
| Molecular Formula | C23H25F3N2S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (5aR,6S,7R)-5a,6-dimethyl-7-prop-1-en-2-yl-N-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-benzo[g][1,3]benzothiazol-2-amine |
| SMILES | C=C(C)[C@@H]1CC=C2c3sc(Nc4cccc(C(F)(F)F)c4)nc3CC[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C23H25F3N2S/c1-13(2)17-8-9-18-20-19(10-11-22(18,4)14(17)3)28-21(29-20)27-16-7-5-6-15(12-16)23(24,25)26/h5-7,9,12,14,17H,1,8,10-11H2,2-4H3,(H,27,28)/t14-,17-,22+/m0/s1 |
| InChIKey | XFWMCXBKIAELSS-ICSGCJEQSA-N |
| XLogP | 7.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|