About methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid
methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid (PubChem CID 174232196) has the molecular formula C15H16N2O4
and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid.
Molecular Properties
| Compound Name | methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid |
| PubChem CID | 174232196 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid |
| SMILES | CN(C[C@@H]1CCOc2c(-c3cocn3)cccc21)C(=O)O |
| InChI | InChI=1S/C15H16N2O4/c1-17(15(18)19)7-10-5-6-21-14-11(10)3-2-4-12(14)13-8-20-9-16-13/h2-4,8-10H,5-7H2,1H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | LTRPYKQETKITFP-JTQLQIEISA-N |
| XLogP | 2.82 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid?
The IUPAC name of methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid (CID 174232196) is methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid.
What is the SMILES notation for methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid?
The canonical SMILES for methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid is CN(C[C@@H]1CCOc2c(-c3cocn3)cccc21)C(=O)O.
What is the InChIKey of methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid?
The InChIKey is LTRPYKQETKITFP-JTQLQIEISA-N. The full InChI is InChI=1S/C15H16N2O4/c1-17(15(18)19)7-10-5-6-21-14-11(10)3-2-4-12(14)13-8-20-9-16-13/h2-4,8-10H,5-7H2,1H3,(H,18,19)/t10-/m0/s1.
What are the key properties of methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid?
methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid has a molecular weight of 288.30 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[[(4R)-8-(1,3-oxazol-4-yl)-3,4-dihydro-2H-chromen-4-yl]methyl]carbamic acid is sourced from PubChem (CID 174232196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).