C21H20F3NO5 — CID 174232309
(2S)-2-[1-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2,2,2-trifluoroethoxy]propanoic acid (PubChem CID 174232309) has the molecular formula C21H20F3NO5 and a molecular weight of 423.39 g/mol. Its IUPAC name is (2S)-2-[1-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2,2,2-trifluoroethoxy]propanoic acid.
| Compound Name | (2S)-2-[1-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2,2,2-trifluoroethoxy]propanoic acid |
|---|---|
| PubChem CID | 174232309 |
| Molecular Formula | C21H20F3NO5 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (2S)-2-[1-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-2,2,2-trifluoroethoxy]propanoic acid |
| SMILES | C[C@H](OC(N(C)C(=O)OCC1c2ccccc2-c2ccccc21)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C21H20F3NO5/c1-12(18(26)27)30-19(21(22,23)24)25(2)20(28)29-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,12,17,19H,11H2,1-2H3,(H,26,27)/t12-,19?/m0/s1 |
| InChIKey | XKEISWVQCYIUGH-HSLMYDHPSA-N |
| XLogP | 4.25 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|