C22H21N5O3 — CID 174232330
5-(2,3-dihydro-1H-inden-1-yl)-N-(5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 174232330) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-1-yl)-N-(5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-(2,3-dihydro-1H-inden-1-yl)-N-(5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 174232330 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-1-yl)-N-(5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)C(NC(=O)c2n[nH]c(C3CCc4ccccc43)n2)COc2ccccc21 |
| InChI | InChI=1S/C22H21N5O3/c1-27-17-8-4-5-9-18(17)30-12-16(22(27)29)23-21(28)20-24-19(25-26-20)15-11-10-13-6-2-3-7-14(13)15/h2-9,15-16H,10-12H2,1H3,(H,23,28)(H,24,25,26) |
| InChIKey | GWUHQVMLDCUOBS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |