C22H28BrN5O4 — CID 174232771
[(1R,2S,5S)-3-[(2S)-2-amino-3,3-dimethylbutanoyl]-2-[[(5-bromo-3-pyridinyl)-cyanomethyl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-1-yl] formate (PubChem CID 174232771) has the molecular formula C22H28BrN5O4 and a molecular weight of 506.40 g/mol. Its IUPAC name is [(1R,2S,5S)-3-[(2S)-2-amino-3,3-dimethylbutanoyl]-2-[[(5-bromo-3-pyridinyl)-cyanomethyl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-1-yl] formate.
| Compound Name | [(1R,2S,5S)-3-[(2S)-2-amino-3,3-dimethylbutanoyl]-2-[[(5-bromo-3-pyridinyl)-cyanomethyl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-1-yl] formate |
|---|---|
| PubChem CID | 174232771 |
| Molecular Formula | C22H28BrN5O4 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | [(1R,2S,5S)-3-[(2S)-2-amino-3,3-dimethylbutanoyl]-2-[[(5-bromo-3-pyridinyl)-cyanomethyl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-1-yl] formate |
| SMILES | CC(C)(C)[C@H](N)C(=O)N1C[C@@H]2C(C)(C)[C@@]2(OC=O)[C@H]1C(=O)NC(C#N)c1cncc(Br)c1 |
| InChI | InChI=1S/C22H28BrN5O4/c1-20(2,3)16(25)19(31)28-10-15-21(4,5)22(15,32-11-29)17(28)18(30)27-14(7-24)12-6-13(23)9-26-8-12/h6,8-9,11,14-17H,10,25H2,1-5H3,(H,27,30)/t14?,15-,16-,17-,22+/m1/s1 |
| InChIKey | HXGUMRXTYAOXBH-MLPJTASZSA-N |
| XLogP | 1.68 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|