C28H29F6N7O5 — CID 174232848
3-[6-[[[1-[6-(2,6-diazaspiro[3.4]octan-6-yl)pyridazin-3-yl]-2,2,2-trifluoroethyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 174232848) has the molecular formula C28H29F6N7O5 and a molecular weight of 657.57 g/mol. Its IUPAC name is 3-[6-[[[1-[6-(2,6-diazaspiro[3.4]octan-6-yl)pyridazin-3-yl]-2,2,2-trifluoroethyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[6-[[[1-[6-(2,6-diazaspiro[3.4]octan-6-yl)pyridazin-3-yl]-2,2,2-trifluoroethyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174232848 |
| Molecular Formula | C28H29F6N7O5 |
| Molecular Weight | 657.57 g/mol |
| Exact Mass | 657.21 |
| IUPAC Name | 3-[6-[[[1-[6-(2,6-diazaspiro[3.4]octan-6-yl)pyridazin-3-yl]-2,2,2-trifluoroethyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CCC(N2Cc3cc(CNC(c4ccc(N5CCC6(CNC6)C5)nn4)C(F)(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H28F3N7O3.C2HF3O2/c27-26(28,29)22(18-3-5-20(34-33-18)35-8-7-25(14-35)12-30-13-25)31-10-15-1-2-17-16(9-15)11-36(24(17)39)19-4-6-21(37)32-23(19)38;3-2(4,5)1(6)7/h1-3,5,9,19,22,30-31H,4,6-8,10-14H2,(H,32,37,38);(H,6,7) |
| InChIKey | NTHVGSDRESUZBC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|