C23H26F2N3O3S- — CID 174232887
(2S,3S)-1-(azetidine-1-carbonyl)-2-[[3-(3,5-difluorophenyl)phenyl]methyl]-3-[2-(sulfinatoamino)ethyl]pyrrolidine (PubChem CID 174232887) has the molecular formula C23H26F2N3O3S- and a molecular weight of 462.54 g/mol. Its IUPAC name is (2S,3S)-1-(azetidine-1-carbonyl)-2-[[3-(3,5-difluorophenyl)phenyl]methyl]-3-[2-(sulfinatoamino)ethyl]pyrrolidine.
| Compound Name | (2S,3S)-1-(azetidine-1-carbonyl)-2-[[3-(3,5-difluorophenyl)phenyl]methyl]-3-[2-(sulfinatoamino)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 174232887 |
| Molecular Formula | C23H26F2N3O3S- |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (2S,3S)-1-(azetidine-1-carbonyl)-2-[[3-(3,5-difluorophenyl)phenyl]methyl]-3-[2-(sulfinatoamino)ethyl]pyrrolidine |
| SMILES | O=C(N1CCC1)N1CC[C@@H](CCNS(=O)[O-])[C@@H]1Cc1cccc(-c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C23H27F2N3O3S/c24-20-13-19(14-21(25)15-20)18-4-1-3-16(11-18)12-22-17(5-7-26-32(30)31)6-10-28(22)23(29)27-8-2-9-27/h1,3-4,11,13-15,17,22,26H,2,5-10,12H2,(H,30,31)/p-1/t17-,22+/m1/s1 |
| InChIKey | DEKZQMROBZLSJB-VGSWGCGISA-M |
| XLogP | 3.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|