C28H36IN5O2 — CID 174233267
tert-butyl 4-[6-[4-(2-iodo-1-propan-2-ylazetidin-3-yl)phenyl]pyrrolo[1,2-b]pyridazin-4-yl]piperazine-1-carboxylate (PubChem CID 174233267) has the molecular formula C28H36IN5O2 and a molecular weight of 601.53 g/mol. Its IUPAC name is tert-butyl 4-[6-[4-(2-iodo-1-propan-2-ylazetidin-3-yl)phenyl]pyrrolo[1,2-b]pyridazin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[4-(2-iodo-1-propan-2-ylazetidin-3-yl)phenyl]pyrrolo[1,2-b]pyridazin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174233267 |
| Molecular Formula | C28H36IN5O2 |
| Molecular Weight | 601.53 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | tert-butyl 4-[6-[4-(2-iodo-1-propan-2-ylazetidin-3-yl)phenyl]pyrrolo[1,2-b]pyridazin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)N1CC(c2ccc(-c3cc4c(N5CCN(C(=O)OC(C)(C)C)CC5)ccnn4c3)cc2)C1I |
| InChI | InChI=1S/C28H36IN5O2/c1-19(2)33-18-23(26(33)29)21-8-6-20(7-9-21)22-16-25-24(10-11-30-34(25)17-22)31-12-14-32(15-13-31)27(35)36-28(3,4)5/h6-11,16-17,19,23,26H,12-15,18H2,1-5H3 |
| InChIKey | VNUBMXHUHABBDI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|