C7H7F3N2O3 — CID 174233674
1-(3,3,3-trifluoro-2-hydroxypropyl)pyrimidine-2,4-dione (PubChem CID 174233674) has the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. Its IUPAC name is 1-(3,3,3-trifluoro-2-hydroxypropyl)pyrimidine-2,4-dione.
| Compound Name | 1-(3,3,3-trifluoro-2-hydroxypropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174233674 |
| Molecular Formula | C7H7F3N2O3 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1-(3,3,3-trifluoro-2-hydroxypropyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CC(O)C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C7H7F3N2O3/c8-7(9,10)4(13)3-12-2-1-5(14)11-6(12)15/h1-2,4,13H,3H2,(H,11,14,15) |
| InChIKey | LZNDAVKKVCWFQB-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |