C18H17ClN2O4 — CID 174233963
[4-[(carbamoylamino)methyl]-2-methoxyphenyl] (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 174233963) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is [4-[(carbamoylamino)methyl]-2-methoxyphenyl] (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | [4-[(carbamoylamino)methyl]-2-methoxyphenyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 174233963 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | [4-[(carbamoylamino)methyl]-2-methoxyphenyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | COc1cc(CNC(N)=O)ccc1OC(=O)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClN2O4/c1-24-16-10-13(11-21-18(20)23)5-7-15(16)25-17(22)8-6-12-3-2-4-14(19)9-12/h2-10H,11H2,1H3,(H3,20,21,23)/b8-6+ |
| InChIKey | UJYWQZQKFQYXON-SOFGYWHQSA-N |
| XLogP | 3.14 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|