About N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide
N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide (PubChem CID 174234358) has the molecular formula C7H12F2N2O2S
and a molecular weight of 226.25 g/mol. Its IUPAC name is N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide |
| PubChem CID | 174234358 |
| Molecular Formula | C7H12F2N2O2S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)N[C@@H](C#N)C(F)F |
| InChI | InChI=1S/C7H12F2N2O2S/c1-7(2,3)14(12,13)11-5(4-10)6(8)9/h5-6,11H,1-3H3/t5-/m0/s1 |
| InChIKey | JLKOKBLYJNOJMD-YFKPBYRVSA-N |
| XLogP | 0.86 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide?
The IUPAC name of N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide (CID 174234358) is N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide.
What is the SMILES notation for N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide?
The canonical SMILES for N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide is CC(C)(C)S(=O)(=O)N[C@@H](C#N)C(F)F.
What is the InChIKey of N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide?
The InChIKey is JLKOKBLYJNOJMD-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H12F2N2O2S/c1-7(2,3)14(12,13)11-5(4-10)6(8)9/h5-6,11H,1-3H3/t5-/m0/s1.
What are the key properties of N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide?
N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide has a molecular weight of 226.25 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-cyano-2,2-difluoroethyl]-2-methylpropane-2-sulfonamide is sourced from PubChem (CID 174234358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).