C11H18N2O5 — CID 174234414
(3aS,4R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylic acid;acetonitrile (PubChem CID 174234414) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylic acid;acetonitrile.
| Compound Name | (3aS,4R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylic acid;acetonitrile |
|---|---|
| PubChem CID | 174234414 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (3aS,4R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylic acid;acetonitrile |
| SMILES | CC#N.CC1(C)O[C@H]2[C@@H](CO)N(C(=O)O)C[C@H]2O1 |
| InChI | InChI=1S/C9H15NO5.C2H3N/c1-9(2)14-6-3-10(8(12)13)5(4-11)7(6)15-9;1-2-3/h5-7,11H,3-4H2,1-2H3,(H,12,13);1H3/t5-,6-,7+;/m1./s1 |
| InChIKey | RNBIANCYHQAYSS-IXUZKAFRSA-N |
| XLogP | 0.39 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |