C13H21NO6 — CID 174234421
ethyl (3aS,4R,6aR)-4-(acetyloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 174234421) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is ethyl (3aS,4R,6aR)-4-(acetyloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | ethyl (3aS,4R,6aR)-4-(acetyloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 174234421 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | ethyl (3aS,4R,6aR)-4-(acetyloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)N1C[C@H]2OC(C)(C)O[C@H]2[C@H]1COC(C)=O |
| InChI | InChI=1S/C13H21NO6/c1-5-17-12(16)14-6-10-11(20-13(3,4)19-10)9(14)7-18-8(2)15/h9-11H,5-7H2,1-4H3/t9-,10-,11+/m1/s1 |
| InChIKey | IAAGRKQZNOCJRY-MXWKQRLJSA-N |
| XLogP | 0.91 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |