C23H26F3N5O2S — CID 174234443
4-ethyl-5-(hydroxymethyl)-2-[2-(2-methylsulfanylphenyl)-4-(1,1,1-trifluoropropan-2-yl)-2,3-dihydro-1H-quinoxalin-6-yl]-1,2,4-triazol-3-one (PubChem CID 174234443) has the molecular formula C23H26F3N5O2S and a molecular weight of 493.56 g/mol. Its IUPAC name is 4-ethyl-5-(hydroxymethyl)-2-[2-(2-methylsulfanylphenyl)-4-(1,1,1-trifluoropropan-2-yl)-2,3-dihydro-1H-quinoxalin-6-yl]-1,2,4-triazol-3-one.
| Compound Name | 4-ethyl-5-(hydroxymethyl)-2-[2-(2-methylsulfanylphenyl)-4-(1,1,1-trifluoropropan-2-yl)-2,3-dihydro-1H-quinoxalin-6-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 174234443 |
| Molecular Formula | C23H26F3N5O2S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 4-ethyl-5-(hydroxymethyl)-2-[2-(2-methylsulfanylphenyl)-4-(1,1,1-trifluoropropan-2-yl)-2,3-dihydro-1H-quinoxalin-6-yl]-1,2,4-triazol-3-one |
| SMILES | CCn1c(CO)nn(-c2ccc3c(c2)N(C(C)C(F)(F)F)CC(c2ccccc2SC)N3)c1=O |
| InChI | InChI=1S/C23H26F3N5O2S/c1-4-29-21(13-32)28-31(22(29)33)15-9-10-17-19(11-15)30(14(2)23(24,25)26)12-18(27-17)16-7-5-6-8-20(16)34-3/h5-11,14,18,27,32H,4,12-13H2,1-3H3 |
| InChIKey | DDVRZRRLNVTOGZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |