C18H17ClF3NO5S — CID 174236132
[2-(2-chlorophenyl)-6-sulfamoyl-3-(trifluoromethoxy)phenyl] pentanoate (PubChem CID 174236132) has the molecular formula C18H17ClF3NO5S and a molecular weight of 451.85 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-6-sulfamoyl-3-(trifluoromethoxy)phenyl] pentanoate.
| Compound Name | [2-(2-chlorophenyl)-6-sulfamoyl-3-(trifluoromethoxy)phenyl] pentanoate |
|---|---|
| PubChem CID | 174236132 |
| Molecular Formula | C18H17ClF3NO5S |
| Molecular Weight | 451.85 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | [2-(2-chlorophenyl)-6-sulfamoyl-3-(trifluoromethoxy)phenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1c(S(N)(=O)=O)ccc(OC(F)(F)F)c1-c1ccccc1Cl |
| InChI | InChI=1S/C18H17ClF3NO5S/c1-2-3-8-15(24)27-17-14(29(23,25)26)10-9-13(28-18(20,21)22)16(17)11-6-4-5-7-12(11)19/h4-7,9-10H,2-3,8H2,1H3,(H2,23,25,26) |
| InChIKey | MPHZLNRPRLXJKH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|