About (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane
(1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 174236314) has the molecular formula C15H19FN2O
and a molecular weight of 262.33 g/mol. Its IUPAC name is (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane |
| PubChem CID | 174236314 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | Fc1cccc2c1CN(C[C@@]13CN[C@@H](CO1)C3)CC2 |
| InChI | InChI=1S/C15H19FN2O/c16-14-3-1-2-11-4-5-18(7-13(11)14)10-15-6-12(8-19-15)17-9-15/h1-3,12,17H,4-10H2/t12-,15-/m1/s1 |
| InChIKey | AJSFVGSSEZWXEQ-IUODEOHRSA-N |
| XLogP | 1.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane?
The IUPAC name of (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane (CID 174236314) is (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane.
What is the SMILES notation for (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane?
The canonical SMILES for (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane is Fc1cccc2c1CN(C[C@@]13CN[C@@H](CO1)C3)CC2.
What is the InChIKey of (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane?
The InChIKey is AJSFVGSSEZWXEQ-IUODEOHRSA-N. The full InChI is InChI=1S/C15H19FN2O/c16-14-3-1-2-11-4-5-18(7-13(11)14)10-15-6-12(8-19-15)17-9-15/h1-3,12,17H,4-10H2/t12-,15-/m1/s1.
What are the key properties of (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane?
(1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane has a molecular weight of 262.33 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-1-[(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-2-oxa-5-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 174236314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).