C13H23NO7 — CID 174237519
(3aS,4R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylic acid;ethyl acetate (PubChem CID 174237519) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylic acid;ethyl acetate.
| Compound Name | (3aS,4R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylic acid;ethyl acetate |
|---|---|
| PubChem CID | 174237519 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (3aS,4R,6aR)-4-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylic acid;ethyl acetate |
| SMILES | CC1(C)O[C@H]2[C@@H](CO)N(C(=O)O)C[C@H]2O1.CCOC(C)=O |
| InChI | InChI=1S/C9H15NO5.C4H8O2/c1-9(2)14-6-3-10(8(12)13)5(4-11)7(6)15-9;1-3-6-4(2)5/h5-7,11H,3-4H2,1-2H3,(H,12,13);3H2,1-2H3/t5-,6-,7+;/m1./s1 |
| InChIKey | MOSXKZFSZRIBII-IXUZKAFRSA-N |
| XLogP | 0.43 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |