C34H52N6O8 — CID 174237768
2-[[6-[2-bicyclo[2.2.1]heptanyl(methyl)amino]-2-[[2-[[2-[[2-[(4-tert-butylbenzoyl)amino]acetyl]amino]acetyl]amino]acetyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 174237768) has the molecular formula C34H52N6O8 and a molecular weight of 672.82 g/mol. Its IUPAC name is 2-[[6-[2-bicyclo[2.2.1]heptanyl(methyl)amino]-2-[[2-[[2-[[2-[(4-tert-butylbenzoyl)amino]acetyl]amino]acetyl]amino]acetyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[6-[2-bicyclo[2.2.1]heptanyl(methyl)amino]-2-[[2-[[2-[[2-[(4-tert-butylbenzoyl)amino]acetyl]amino]acetyl]amino]acetyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 174237768 |
| Molecular Formula | C34H52N6O8 |
| Molecular Weight | 672.82 g/mol |
| Exact Mass | 672.38 |
| IUPAC Name | 2-[[6-[2-bicyclo[2.2.1]heptanyl(methyl)amino]-2-[[2-[[2-[[2-[(4-tert-butylbenzoyl)amino]acetyl]amino]acetyl]amino]acetyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CN(CCCCC(NC(=O)CNC(=O)CNC(=O)CNC(=O)c1ccc(C(C)(C)C)cc1)C(=O)NC(CO)C(=O)O)C1CC2CCC1C2 |
| InChI | InChI=1S/C34H52N6O8/c1-34(2,3)24-12-10-22(11-13-24)31(45)37-18-29(43)35-17-28(42)36-19-30(44)38-25(32(46)39-26(20-41)33(47)48)7-5-6-14-40(4)27-16-21-8-9-23(27)15-21/h10-13,21,23,25-27,41H,5-9,14-20H2,1-4H3,(H,35,43)(H,36,42)(H,37,45)(H,38,44)(H,39,46)(H,47,48) |
| InChIKey | BQYATMPQAYFGIX-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 206.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.82 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|