C40H44N4O8S — CID 174237806
3-[4-[2-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]ethoxy]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 174237806) has the molecular formula C40H44N4O8S and a molecular weight of 740.88 g/mol. Its IUPAC name is 3-[4-[2-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]ethoxy]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[4-[2-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]ethoxy]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 174237806 |
| Molecular Formula | C40H44N4O8S |
| Molecular Weight | 740.88 g/mol |
| Exact Mass | 740.29 |
| IUPAC Name | 3-[4-[2-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]ethoxy]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCOc2ccc(CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)cc2)c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C40H44N4O8S/c1-23-24(2)36(25(3)32-21-40(4,5)52-35(23)32)53(48,49)44-38(41)42-18-19-50-27-16-14-26(15-17-27)20-34(37(45)46)43-39(47)51-22-33-30-12-8-6-10-28(30)29-11-7-9-13-31(29)33/h6-17,33-34H,18-22H2,1-5H3,(H,43,47)(H,45,46)(H3,41,42,44) |
| InChIKey | HWDBNMXJOIPWLJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 178.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.88 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|