C26H25F5N4O3 — CID 174238136
N-[(1S)-3,3-difluoro-1-(hydroxymethyl)cyclopentyl]-3-[3-(difluoromethoxy)phenyl]-1-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 174238136) has the molecular formula C26H25F5N4O3 and a molecular weight of 536.50 g/mol. Its IUPAC name is N-[(1S)-3,3-difluoro-1-(hydroxymethyl)cyclopentyl]-3-[3-(difluoromethoxy)phenyl]-1-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | N-[(1S)-3,3-difluoro-1-(hydroxymethyl)cyclopentyl]-3-[3-(difluoromethoxy)phenyl]-1-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 174238136 |
| Molecular Formula | C26H25F5N4O3 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | N-[(1S)-3,3-difluoro-1-(hydroxymethyl)cyclopentyl]-3-[3-(difluoromethoxy)phenyl]-1-(5-fluoro-2-pyridinyl)-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | O=C(N[C@@]1(CO)CCC(F)(F)C1)C1CCc2c(-c3cccc(OC(F)F)c3)nn(-c3ccc(F)cn3)c2C1 |
| InChI | InChI=1S/C26H25F5N4O3/c27-17-5-7-21(32-12-17)35-20-11-16(23(37)33-25(14-36)8-9-26(30,31)13-25)4-6-19(20)22(34-35)15-2-1-3-18(10-15)38-24(28)29/h1-3,5,7,10,12,16,24,36H,4,6,8-9,11,13-14H2,(H,33,37)/t16?,25-/m0/s1 |
| InChIKey | CHTRFQKLADJXIP-JIKORUOASA-N |
| XLogP | 4.45 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |