C27H28FN5O2S — CID 174238361
2-[3-[(4-fluorophenyl)methyl]imidazo[4,5-b]pyridin-2-yl]sulfanyl-N-[1-(4-morpholin-4-ylphenyl)ethyl]acetamide (PubChem CID 174238361) has the molecular formula C27H28FN5O2S and a molecular weight of 505.62 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methyl]imidazo[4,5-b]pyridin-2-yl]sulfanyl-N-[1-(4-morpholin-4-ylphenyl)ethyl]acetamide.
| Compound Name | 2-[3-[(4-fluorophenyl)methyl]imidazo[4,5-b]pyridin-2-yl]sulfanyl-N-[1-(4-morpholin-4-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 174238361 |
| Molecular Formula | C27H28FN5O2S |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methyl]imidazo[4,5-b]pyridin-2-yl]sulfanyl-N-[1-(4-morpholin-4-ylphenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CSc1nc2cccnc2n1Cc1ccc(F)cc1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H28FN5O2S/c1-19(21-6-10-23(11-7-21)32-13-15-35-16-14-32)30-25(34)18-36-27-31-24-3-2-12-29-26(24)33(27)17-20-4-8-22(28)9-5-20/h2-12,19H,13-18H2,1H3,(H,30,34) |
| InChIKey | YFOWXIHJIYBSJU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|