C26H30BClFNO3 — CID 174238402
7-chloro-2-[cyclopropyl-(4-fluoro-3-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroisoquinolin-1-one (PubChem CID 174238402) has the molecular formula C26H30BClFNO3 and a molecular weight of 469.79 g/mol. Its IUPAC name is 7-chloro-2-[cyclopropyl-(4-fluoro-3-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroisoquinolin-1-one.
| Compound Name | 7-chloro-2-[cyclopropyl-(4-fluoro-3-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 174238402 |
| Molecular Formula | C26H30BClFNO3 |
| Molecular Weight | 469.79 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 7-chloro-2-[cyclopropyl-(4-fluoro-3-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroisoquinolin-1-one |
| SMILES | Cc1cc(C(C2CC2)N2CCc3c(B4OC(C)(C)C(C)(C)O4)cc(Cl)cc3C2=O)ccc1F |
| InChI | InChI=1S/C26H30BClFNO3/c1-15-12-17(8-9-22(15)29)23(16-6-7-16)30-11-10-19-20(24(30)31)13-18(28)14-21(19)27-32-25(2,3)26(4,5)33-27/h8-9,12-14,16,23H,6-7,10-11H2,1-5H3 |
| InChIKey | ZREHHWDYRYKBEJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|